About 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine
4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine (PubChem CID 144639240) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine.
Molecular Properties
| Compound Name | 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine |
| PubChem CID | 144639240 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine |
| SMILES | C=C(N)CC(=C)C(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-14(13-15(2)19)18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3,5-7,9-12,18H,1-2,4,8,13,19H2 |
| InChIKey | TVDSMMZMFHTJJJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine?
The IUPAC name of 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine (CID 144639240) is 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine.
What is the SMILES notation for 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine?
The canonical SMILES for 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine is C=C(N)CC(=C)C(C1=CCCC=C1)c1ccccc1.
What is the InChIKey of 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine?
The InChIKey is TVDSMMZMFHTJJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N/c1-14(13-15(2)19)18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3,5-7,9-12,18H,1-2,4,8,13,19H2.
What are the key properties of 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine?
4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine has a molecular weight of 251.37 g/mol, XLogP of 4.47, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]penta-1,4-dien-2-amine is sourced from PubChem (CID 144639240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).