C16H18N2O — CID 144639378
5-amino-2-[1-(3,5-dimethylphenyl)ethenylamino]phenol (PubChem CID 144639378) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 5-amino-2-[1-(3,5-dimethylphenyl)ethenylamino]phenol.
| Compound Name | 5-amino-2-[1-(3,5-dimethylphenyl)ethenylamino]phenol |
|---|---|
| PubChem CID | 144639378 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 5-amino-2-[1-(3,5-dimethylphenyl)ethenylamino]phenol |
| SMILES | C=C(Nc1ccc(N)cc1O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H18N2O/c1-10-6-11(2)8-13(7-10)12(3)18-15-5-4-14(17)9-16(15)19/h4-9,18-19H,3,17H2,1-2H3 |
| InChIKey | GDAFWONGEBYFMI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|