C40H33N — CID 144639849
2-(9,9-diphenylfluoren-3-yl)-1-[4-(4-methylcyclohexa-1,5-dien-1-yl)phenyl]ethanimine (PubChem CID 144639849) has the molecular formula C40H33N and a molecular weight of 527.71 g/mol. Its IUPAC name is 2-(9,9-diphenylfluoren-3-yl)-1-[4-(4-methylcyclohexa-1,5-dien-1-yl)phenyl]ethanimine.
| Compound Name | 2-(9,9-diphenylfluoren-3-yl)-1-[4-(4-methylcyclohexa-1,5-dien-1-yl)phenyl]ethanimine |
|---|---|
| PubChem CID | 144639849 |
| Molecular Formula | C40H33N |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 2-(9,9-diphenylfluoren-3-yl)-1-[4-(4-methylcyclohexa-1,5-dien-1-yl)phenyl]ethanimine |
| SMILES | [H]/N=C(/Cc1ccc2c(c1)-c1ccccc1C2(c1ccccc1)c1ccccc1)c1ccc(C2=CCC(C)C=C2)cc1 |
| InChI | InChI=1S/C40H33N/c1-28-16-19-30(20-17-28)31-21-23-32(24-22-31)39(41)27-29-18-25-38-36(26-29)35-14-8-9-15-37(35)40(38,33-10-4-2-5-11-33)34-12-6-3-7-13-34/h2-16,18-26,28,41H,17,27H2,1H3/b41-39- |
| InChIKey | MBXYIFOHEFYEAI-YTCTUYNNSA-N |
| XLogP | 9.64 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|