C64H64N2 — CID 144640360
4-[10-(4-aminophenyl)-2,3,6-tris(4-tert-butylphenyl)-7-(4-ethylphenyl)anthracen-9-yl]aniline (PubChem CID 144640360) has the molecular formula C64H64N2 and a molecular weight of 861.23 g/mol. Its IUPAC name is 4-[10-(4-aminophenyl)-2,3,6-tris(4-tert-butylphenyl)-7-(4-ethylphenyl)anthracen-9-yl]aniline.
| Compound Name | 4-[10-(4-aminophenyl)-2,3,6-tris(4-tert-butylphenyl)-7-(4-ethylphenyl)anthracen-9-yl]aniline |
|---|---|
| PubChem CID | 144640360 |
| Molecular Formula | C64H64N2 |
| Molecular Weight | 861.23 g/mol |
| Exact Mass | 860.51 |
| IUPAC Name | 4-[10-(4-aminophenyl)-2,3,6-tris(4-tert-butylphenyl)-7-(4-ethylphenyl)anthracen-9-yl]aniline |
| SMILES | CCc1ccc(-c2cc3c(-c4ccc(N)cc4)c4cc(-c5ccc(C(C)(C)C)cc5)c(-c5ccc(C(C)(C)C)cc5)cc4c(-c4ccc(N)cc4)c3cc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C64H64N2/c1-11-40-12-14-41(15-13-40)52-36-56-57(37-53(52)42-16-26-47(27-17-42)62(2,3)4)61(46-24-34-51(66)35-25-46)59-39-55(44-20-30-49(31-21-44)64(8,9)10)54(43-18-28-48(29-19-43)63(5,6)7)38-58(59)60(56)45-22-32-50(65)33-23-45/h12-39H,11,65-66H2,1-10H3 |
| InChIKey | YOEBXJLXFOYGEM-UHFFFAOYSA-N |
| XLogP | 17.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.23 |
| LogP ≤ 5 | 17.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|