C34H36N2 — CID 144640366
4-[10-(4-aminophenyl)-2,6-ditert-butylanthracen-9-yl]aniline (PubChem CID 144640366) has the molecular formula C34H36N2 and a molecular weight of 472.68 g/mol. Its IUPAC name is 4-[10-(4-aminophenyl)-2,6-ditert-butylanthracen-9-yl]aniline.
| Compound Name | 4-[10-(4-aminophenyl)-2,6-ditert-butylanthracen-9-yl]aniline |
|---|---|
| PubChem CID | 144640366 |
| Molecular Formula | C34H36N2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 4-[10-(4-aminophenyl)-2,6-ditert-butylanthracen-9-yl]aniline |
| SMILES | CC(C)(C)c1ccc2c(-c3ccc(N)cc3)c3cc(C(C)(C)C)ccc3c(-c3ccc(N)cc3)c2c1 |
| InChI | InChI=1S/C34H36N2/c1-33(2,3)23-11-17-27-29(19-23)31(21-7-13-25(35)14-8-21)28-18-12-24(34(4,5)6)20-30(28)32(27)22-9-15-26(36)16-10-22/h7-20H,35-36H2,1-6H3 |
| InChIKey | BECPBFQZCNUZSJ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|