About N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane
N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane (PubChem CID 144641608) has the molecular formula C20H39F2NO
and a molecular weight of 347.53 g/mol. Its IUPAC name is N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane.
Molecular Properties
| Compound Name | N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane |
| PubChem CID | 144641608 |
| Molecular Formula | C20H39F2NO |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.30 |
| IUPAC Name | N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane |
| SMILES | CC.CCCCCCCCC(=O)NC/C=C\C(F)(F)CCCCC |
| InChI | InChI=1S/C18H33F2NO.C2H6/c1-3-5-7-8-9-10-13-17(22)21-16-12-15-18(19,20)14-11-6-4-2;1-2/h12,15H,3-11,13-14,16H2,1-2H3,(H,21,22);1-2H3/b15-12-; |
| InChIKey | IMMLWGDGJKLIHM-OBBOLZQKSA-N |
| XLogP | 6.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane?
The IUPAC name of N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane (CID 144641608) is N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane.
What is the SMILES notation for N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane?
The canonical SMILES for N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane is CC.CCCCCCCCC(=O)NC/C=C\C(F)(F)CCCCC.
What is the InChIKey of N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane?
The InChIKey is IMMLWGDGJKLIHM-OBBOLZQKSA-N. The full InChI is InChI=1S/C18H33F2NO.C2H6/c1-3-5-7-8-9-10-13-17(22)21-16-12-15-18(19,20)14-11-6-4-2;1-2/h12,15H,3-11,13-14,16H2,1-2H3,(H,21,22);1-2H3/b15-12-;.
What are the key properties of N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane?
N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane has a molecular weight of 347.53 g/mol, XLogP of 6.65, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4,4-difluoronon-2-enyl]nonanamide;ethane is sourced from PubChem (CID 144641608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).