About ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine
ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine (PubChem CID 144642118) has the molecular formula C16H34N4O
and a molecular weight of 298.47 g/mol. Its IUPAC name is ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine |
| PubChem CID | 144642118 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine |
| SMILES | CC.CN1CCOC2(CCN(C3CCNCC3N)CC2)C1 |
| InChI | InChI=1S/C14H28N4O.C2H6/c1-17-8-9-19-14(11-17)3-6-18(7-4-14)13-2-5-16-10-12(13)15;1-2/h12-13,16H,2-11,15H2,1H3;1-2H3 |
| InChIKey | BUHASRNAAVLHIE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine?
The IUPAC name of ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine (CID 144642118) is ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine.
What is the SMILES notation for ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine?
The canonical SMILES for ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine is CC.CN1CCOC2(CCN(C3CCNCC3N)CC2)C1.
What is the InChIKey of ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine?
The InChIKey is BUHASRNAAVLHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O.C2H6/c1-17-8-9-19-14(11-17)3-6-18(7-4-14)13-2-5-16-10-12(13)15;1-2/h12-13,16H,2-11,15H2,1H3;1-2H3.
What are the key properties of ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine?
ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine has a molecular weight of 298.47 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)piperidin-3-amine is sourced from PubChem (CID 144642118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).