About 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane
4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane (PubChem CID 144642147) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane.
Molecular Properties
| Compound Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane |
| PubChem CID | 144642147 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane |
| SMILES | CC.Nc1cnccc1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H17N3O2.C2H6/c13-10-9-14-4-1-11(10)15-5-2-12(3-6-15)16-7-8-17-12;1-2/h1,4,9H,2-3,5-8,13H2;1-2H3 |
| InChIKey | YDAOAOCUTMOGNJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane?
The IUPAC name of 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane (CID 144642147) is 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane.
What is the SMILES notation for 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane?
The canonical SMILES for 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane is CC.Nc1cnccc1N1CCC2(CC1)OCCO2.
What is the InChIKey of 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane?
The InChIKey is YDAOAOCUTMOGNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2.C2H6/c13-10-9-14-4-1-11(10)15-5-2-12(3-6-15)16-7-8-17-12;1-2/h1,4,9H,2-3,5-8,13H2;1-2H3.
What are the key properties of 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane?
4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane has a molecular weight of 265.36 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyridin-3-amine;ethane is sourced from PubChem (CID 144642147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).