About 6-methyliminohexane-1,2,5-triol
6-methyliminohexane-1,2,5-triol (PubChem CID 144642264) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 6-methyliminohexane-1,2,5-triol.
Molecular Properties
| Compound Name | 6-methyliminohexane-1,2,5-triol |
| PubChem CID | 144642264 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 6-methyliminohexane-1,2,5-triol |
| SMILES | C/N=C/C(O)CCC(O)CO |
| InChI | InChI=1S/C7H15NO3/c1-8-4-6(10)2-3-7(11)5-9/h4,6-7,9-11H,2-3,5H2,1H3/b8-4+ |
| InChIKey | MZVUBTJXUGEHLN-XBXARRHUSA-N |
| XLogP | -0.82 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyliminohexane-1,2,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyliminohexane-1,2,5-triol?
The IUPAC name of 6-methyliminohexane-1,2,5-triol (CID 144642264) is 6-methyliminohexane-1,2,5-triol.
What is the SMILES notation for 6-methyliminohexane-1,2,5-triol?
The canonical SMILES for 6-methyliminohexane-1,2,5-triol is C/N=C/C(O)CCC(O)CO.
What is the InChIKey of 6-methyliminohexane-1,2,5-triol?
The InChIKey is MZVUBTJXUGEHLN-XBXARRHUSA-N. The full InChI is InChI=1S/C7H15NO3/c1-8-4-6(10)2-3-7(11)5-9/h4,6-7,9-11H,2-3,5H2,1H3/b8-4+.
What are the key properties of 6-methyliminohexane-1,2,5-triol?
6-methyliminohexane-1,2,5-triol has a molecular weight of 161.20 g/mol, XLogP of -0.82, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyliminohexane-1,2,5-triol is sourced from PubChem (CID 144642264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).