C25H41NO2 — CID 144642339
(Z)-N-[4-[(2E,4E)-3-methyl-5-(4,6,6-trimethyloxan-2-yl)penta-2,4-dienyl]cyclohexyl]pent-2-enamide (PubChem CID 144642339) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is (Z)-N-[4-[(2E,4E)-3-methyl-5-(4,6,6-trimethyloxan-2-yl)penta-2,4-dienyl]cyclohexyl]pent-2-enamide.
| Compound Name | (Z)-N-[4-[(2E,4E)-3-methyl-5-(4,6,6-trimethyloxan-2-yl)penta-2,4-dienyl]cyclohexyl]pent-2-enamide |
|---|---|
| PubChem CID | 144642339 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | (Z)-N-[4-[(2E,4E)-3-methyl-5-(4,6,6-trimethyloxan-2-yl)penta-2,4-dienyl]cyclohexyl]pent-2-enamide |
| SMILES | CC/C=C\C(=O)NC1CCC(C/C=C(C)/C=C/C2CC(C)CC(C)(C)O2)CC1 |
| InChI | InChI=1S/C25H41NO2/c1-6-7-8-24(27)26-22-14-12-21(13-15-22)11-9-19(2)10-16-23-17-20(3)18-25(4,5)28-23/h7-10,16,20-23H,6,11-15,17-18H2,1-5H3,(H,26,27)/b8-7-,16-10+,19-9+ |
| InChIKey | GLKCEJBXCHYFCE-UPEIUGEVSA-N |
| XLogP | 6.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|