C15H15BFN5O2 — CID 144642488
3-[(8-fluoro-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)amino]boretane-1-carbonitrile (PubChem CID 144642488) has the molecular formula C15H15BFN5O2 and a molecular weight of 327.13 g/mol. Its IUPAC name is 3-[(8-fluoro-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)amino]boretane-1-carbonitrile.
| Compound Name | 3-[(8-fluoro-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)amino]boretane-1-carbonitrile |
|---|---|
| PubChem CID | 144642488 |
| Molecular Formula | C15H15BFN5O2 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[(8-fluoro-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)amino]boretane-1-carbonitrile |
| SMILES | CC1C(=O)NN=C2COc3cc(F)c(NC4CB(C#N)C4)cc3N21 |
| InChI | InChI=1S/C15H15BFN5O2/c1-8-15(23)21-20-14-6-24-13-2-10(17)11(3-12(13)22(8)14)19-9-4-16(5-9)7-18/h2-3,8-9,19H,4-6H2,1H3,(H,21,23) |
| InChIKey | HQMPWRNYHRGLJA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|