C17H25N5O2 — CID 144642540
9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;1,3-dimethylpyrrolidine (PubChem CID 144642540) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;1,3-dimethylpyrrolidine.
| Compound Name | 9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;1,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 144642540 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;1,3-dimethylpyrrolidine |
| SMILES | CC1C(=O)NN=C2COc3ccc(N)cc3N21.CC1CCN(C)C1 |
| InChI | InChI=1S/C11H12N4O2.C6H13N/c1-6-11(16)14-13-10-5-17-9-3-2-7(12)4-8(9)15(6)10;1-6-3-4-7(2)5-6/h2-4,6H,5,12H2,1H3,(H,14,16);6H,3-5H2,1-2H3 |
| InChIKey | OJVPCQWTRXFTCU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|