About cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane
cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane (PubChem CID 144642711) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane.
Molecular Properties
| Compound Name | cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane |
| PubChem CID | 144642711 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane |
| SMILES | C=CCO[C@H]1CCC[C@@H](C)C1.CCC |
| InChI | InChI=1S/C10H18O.C3H8/c1-3-7-11-10-6-4-5-9(2)8-10;1-3-2/h3,9-10H,1,4-8H2,2H3;3H2,1-2H3/t9-,10+;/m1./s1 |
| InChIKey | OKWYEWCDXWRCND-UXQCFNEQSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane?
The IUPAC name of cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane (CID 144642711) is cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane.
What is the SMILES notation for cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane?
The canonical SMILES for cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane is C=CCO[C@H]1CCC[C@@H](C)C1.CCC.
What is the InChIKey of cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane?
The InChIKey is OKWYEWCDXWRCND-UXQCFNEQSA-N. The full InChI is InChI=1S/C10H18O.C3H8/c1-3-7-11-10-6-4-5-9(2)8-10;1-3-2/h3,9-10H,1,4-8H2,2H3;3H2,1-2H3/t9-,10+;/m1./s1.
What are the key properties of cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane?
cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane has a molecular weight of 198.35 g/mol, XLogP of 4.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-1-methyl-3-prop-2-enoxycyclohexane;propane is sourced from PubChem (CID 144642711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).