About N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine
N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine (PubChem CID 144643447) has the molecular formula C13H25N5O7S
and a molecular weight of 395.44 g/mol. Its IUPAC name is N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine.
Molecular Properties
| Compound Name | N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine |
| PubChem CID | 144643447 |
| Molecular Formula | C13H25N5O7S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine |
| SMILES | C1CCNCC1.O=C1N2CCCC(C2)N1OS(=O)(=O)O.O=CNNC=O |
| InChI | InChI=1S/C6H10N2O5S.C5H11N.C2H4N2O2/c9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;1-2-4-6-5-3-1;5-1-3-4-2-6/h5H,1-4H2,(H,10,11,12);6H,1-5H2;1-2H,(H,3,5)(H,4,6) |
| InChIKey | LMJXZERIGKBFCV-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine?
The IUPAC name of N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine (CID 144643447) is N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine.
What is the SMILES notation for N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine?
The canonical SMILES for N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine is C1CCNCC1.O=C1N2CCCC(C2)N1OS(=O)(=O)O.O=CNNC=O.
What is the InChIKey of N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine?
The InChIKey is LMJXZERIGKBFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O5S.C5H11N.C2H4N2O2/c9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;1-2-4-6-5-3-1;5-1-3-4-2-6/h5H,1-4H2,(H,10,11,12);6H,1-5H2;1-2H,(H,3,5)(H,4,6).
What are the key properties of N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine?
N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine has a molecular weight of 395.44 g/mol, XLogP of -1.23, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-formamidoformamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine is sourced from PubChem (CID 144643447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).