C9H20N2O — CID 144643638
N-(2-aminoprop-2-enyl)acetamide;2-methylpropane (PubChem CID 144643638) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N-(2-aminoprop-2-enyl)acetamide;2-methylpropane.
| Compound Name | N-(2-aminoprop-2-enyl)acetamide;2-methylpropane |
|---|---|
| PubChem CID | 144643638 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N-(2-aminoprop-2-enyl)acetamide;2-methylpropane |
| SMILES | C=C(N)CNC(C)=O.CC(C)C |
| InChI | InChI=1S/C5H10N2O.C4H10/c1-4(6)3-7-5(2)8;1-4(2)3/h1,3,6H2,2H3,(H,7,8);4H,1-3H3 |
| InChIKey | OKMKQAOPSSKNDC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |