C24H43N7O2 — CID 144644441
3-[(5aR,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea (PubChem CID 144644441) has the molecular formula C24H43N7O2 and a molecular weight of 461.66 g/mol. Its IUPAC name is 3-[(5aR,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea.
| Compound Name | 3-[(5aR,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 144644441 |
| Molecular Formula | C24H43N7O2 |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 461.35 |
| IUPAC Name | 3-[(5aR,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-ethyl-1-[2-[3-methoxypropyl(methyl)amino]ethyl]urea |
| SMILES | CCCN1CC(NC(=O)N(CC)CCN(C)CCCOC)C[C@@H]2Cc3nc(N)ncc3C[C@H]21 |
| InChI | InChI=1S/C24H43N7O2/c1-5-8-31-17-20(13-18-14-21-19(15-22(18)31)16-26-23(25)28-21)27-24(32)30(6-2)11-10-29(3)9-7-12-33-4/h16,18,20,22H,5-15,17H2,1-4H3,(H,27,32)(H2,25,26,28)/t18-,20?,22-/m1/s1 |
| InChIKey | FYQRQDYOIZFIHU-HCNFZCTASA-N |
| XLogP | 1.63 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|