C23H41N7O — CID 144644539
3-[(8S,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-[4-(dimethylamino)butyl]-1-ethylurea (PubChem CID 144644539) has the molecular formula C23H41N7O and a molecular weight of 431.63 g/mol. Its IUPAC name is 3-[(8S,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-[4-(dimethylamino)butyl]-1-ethylurea.
| Compound Name | 3-[(8S,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-[4-(dimethylamino)butyl]-1-ethylurea |
|---|---|
| PubChem CID | 144644539 |
| Molecular Formula | C23H41N7O |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 3-[(8S,9aR)-2-amino-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-8-yl]-1-[4-(dimethylamino)butyl]-1-ethylurea |
| SMILES | CCCN1C[C@@H](NC(=O)N(CC)CCCCN(C)C)C[C@@H]2Cc3nc(N)ncc3CC21 |
| InChI | InChI=1S/C23H41N7O/c1-5-9-30-16-19(26-23(31)29(6-2)11-8-7-10-28(3)4)12-17-13-20-18(14-21(17)30)15-25-22(24)27-20/h15,17,19,21H,5-14,16H2,1-4H3,(H,26,31)(H2,24,25,27)/t17-,19+,21?/m1/s1 |
| InChIKey | HGYTVEKMMQNQJD-VCPDFFEISA-N |
| XLogP | 2.00 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|