C15H19N — CID 144645018
N-[(2E,4Z)-2-methylhexa-2,4-dienyl]-1-phenylethanimine (PubChem CID 144645018) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(2E,4Z)-2-methylhexa-2,4-dienyl]-1-phenylethanimine.
| Compound Name | N-[(2E,4Z)-2-methylhexa-2,4-dienyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 144645018 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-[(2E,4Z)-2-methylhexa-2,4-dienyl]-1-phenylethanimine |
| SMILES | C/C=C\C=C(/C)C/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C15H19N/c1-4-5-9-13(2)12-16-14(3)15-10-7-6-8-11-15/h4-11H,12H2,1-3H3/b5-4-,13-9+,16-14+ |
| InChIKey | SXBLFYOZDLVHOR-UKLZNZMKSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|