C48H30N4 — CID 144645582
11-[4-(4-Naphthalen-1-ylphenyl)quinazolin-2-yl]-7-phenyl-7,11-diazapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),2(10),3,5,8,13,15,17,19-nonaene (PubChem CID 144645582) has the molecular formula C48H30N4 and a molecular weight of 662.80 g/mol. Its IUPAC name is 11-[4-(4-naphthalen-1-ylphenyl)quinazolin-2-yl]-7-phenyl-7,11-diazapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),2(10),3,5,8,13,15,17,19-nonaene.
| Compound Name | 11-[4-(4-Naphthalen-1-ylphenyl)quinazolin-2-yl]-7-phenyl-7,11-diazapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),2(10),3,5,8,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 144645582 |
| Molecular Formula | C48H30N4 |
| Molecular Weight | 662.80 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 11-[4-(4-naphthalen-1-ylphenyl)quinazolin-2-yl]-7-phenyl-7,11-diazapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),2(10),3,5,8,13,15,17,19-nonaene |
| SMILES | C1=CC=C(C=C1)N2C=CC3=CC4=C(C=C32)N(C5=C4C6=CC=CC=C6C=C5)C7=NC8=CC=CC=C8C(=N7)C9=CC=C(C=C9)C1=CC=CC2=CC=CC=C21 |
| InChI | InChI=1S/C48H30N4/c1-2-14-36(15-3-1)51-28-27-35-29-41-45(30-44(35)51)52(43-26-25-32-12-5-7-17-39(32)46(41)43)48-49-42-20-9-8-18-40(42)47(50-48)34-23-21-33(22-24-34)38-19-10-13-31-11-4-6-16-37(31)38/h1-30H |
| InChIKey | ZWEAOBJNKXRSBR-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 35.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | 1210 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.80 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |