C26H21N3 — CID 144645655
N-methyl-2-(9-phenylcarbazole-3-carboximidoyl)aniline (PubChem CID 144645655) has the molecular formula C26H21N3 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-methyl-2-(9-phenylcarbazole-3-carboximidoyl)aniline.
| Compound Name | N-methyl-2-(9-phenylcarbazole-3-carboximidoyl)aniline |
|---|---|
| PubChem CID | 144645655 |
| Molecular Formula | C26H21N3 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-methyl-2-(9-phenylcarbazole-3-carboximidoyl)aniline |
| SMILES | [H]/N=C(/c1ccc2c(c1)c1ccccc1n2-c1ccccc1)c1ccccc1NC |
| InChI | InChI=1S/C26H21N3/c1-28-23-13-7-5-12-21(23)26(27)18-15-16-25-22(17-18)20-11-6-8-14-24(20)29(25)19-9-3-2-4-10-19/h2-17,27-28H,1H3/b27-26- |
| InChIKey | SOOUTDSEJOIJQL-RQZHXJHFSA-N |
| XLogP | 6.24 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|