C19H22BrN — CID 144645865
2-bromo-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene (PubChem CID 144645865) has the molecular formula C19H22BrN and a molecular weight of 344.30 g/mol. Its IUPAC name is 2-bromo-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene.
| Compound Name | 2-bromo-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene |
|---|---|
| PubChem CID | 144645865 |
| Molecular Formula | C19H22BrN |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-bromo-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene |
| SMILES | C=C.C=C/C(=C\C=C/C)c1cc(Br)nc(/C(C=C)=C/C)c1 |
| InChI | InChI=1S/C17H18BrN.C2H4/c1-5-9-10-14(8-4)15-11-16(13(6-2)7-3)19-17(18)12-15;1-2/h5-12H,2,4H2,1,3H3;1-2H2/b9-5-,13-7+,14-10+; |
| InChIKey | ASHYOVTWDQKLII-QQCJWYPJSA-N |
| XLogP | 6.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|