C44H38N4 — CID 144646004
1-[(3E)-penta-1,3-dien-3-yl]-3-N,7,10-triphenylpyrrolo[2,3-a]carbazole-2,3-diamine;toluene (PubChem CID 144646004) has the molecular formula C44H38N4 and a molecular weight of 622.82 g/mol. Its IUPAC name is 1-[(3E)-penta-1,3-dien-3-yl]-3-N,7,10-triphenylpyrrolo[2,3-a]carbazole-2,3-diamine;toluene.
| Compound Name | 1-[(3E)-penta-1,3-dien-3-yl]-3-N,7,10-triphenylpyrrolo[2,3-a]carbazole-2,3-diamine;toluene |
|---|---|
| PubChem CID | 144646004 |
| Molecular Formula | C44H38N4 |
| Molecular Weight | 622.82 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | 1-[(3E)-penta-1,3-dien-3-yl]-3-N,7,10-triphenylpyrrolo[2,3-a]carbazole-2,3-diamine;toluene |
| SMILES | C=C/C(=C\C)n1c(N)c(Nc2ccccc2)c2ccc3c4cc(-c5ccccc5)ccc4n(-c4ccccc4)c3c21.Cc1ccccc1 |
| InChI | InChI=1S/C37H30N4.C7H8/c1-3-28(4-2)41-36-31(34(37(41)38)39-27-16-10-6-11-17-27)22-21-30-32-24-26(25-14-8-5-9-15-25)20-23-33(32)40(35(30)36)29-18-12-7-13-19-29;1-7-5-3-2-4-6-7/h3-24,39H,1,38H2,2H3;2-6H,1H3/b28-4+; |
| InChIKey | CSOWDOHKZURODW-LNLWSFDESA-N |
| XLogP | 11.77 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.82 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|