C35H54N6O6 — CID 144646320
5-[(2-aminoacetyl)amino]-2-(5-aminopentoxy)-N-[(2S)-1-[4-(5-aminopentoxy)-3-(1-hydroxy-2-methylprop-2-enyl)anilino]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 144646320) has the molecular formula C35H54N6O6 and a molecular weight of 654.85 g/mol. Its IUPAC name is 5-[(2-aminoacetyl)amino]-2-(5-aminopentoxy)-N-[(2S)-1-[4-(5-aminopentoxy)-3-(1-hydroxy-2-methylprop-2-enyl)anilino]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 5-[(2-aminoacetyl)amino]-2-(5-aminopentoxy)-N-[(2S)-1-[4-(5-aminopentoxy)-3-(1-hydroxy-2-methylprop-2-enyl)anilino]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 144646320 |
| Molecular Formula | C35H54N6O6 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | 5-[(2-aminoacetyl)amino]-2-(5-aminopentoxy)-N-[(2S)-1-[4-(5-aminopentoxy)-3-(1-hydroxy-2-methylprop-2-enyl)anilino]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | C=C(C)C(O)c1cc(NC(=O)[C@H](CC(C)C)NC(=O)c2cc(NC(=O)CN)ccc2OCCCCCN)ccc1OCCCCCN |
| InChI | InChI=1S/C35H54N6O6/c1-23(2)19-29(35(45)40-26-12-13-30(46-17-9-5-7-15-36)27(20-26)33(43)24(3)4)41-34(44)28-21-25(39-32(42)22-38)11-14-31(28)47-18-10-6-8-16-37/h11-14,20-21,23,29,33,43H,3,5-10,15-19,22,36-38H2,1-2,4H3,(H,39,42)(H,40,45)(H,41,44)/t29-,33?/m0/s1 |
| InChIKey | VUVXHEQQTBVXFM-WXTKOERCSA-N |
| XLogP | 3.99 |
| TPSA | 204.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|