C24H23F2N5O2S — CID 144647144
3-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-[1-(1-ethylsulfanylpiperidin-4-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 144647144) has the molecular formula C24H23F2N5O2S and a molecular weight of 483.54 g/mol. Its IUPAC name is 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-[1-(1-ethylsulfanylpiperidin-4-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-[1-(1-ethylsulfanylpiperidin-4-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 144647144 |
| Molecular Formula | C24H23F2N5O2S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-[1-(1-ethylsulfanylpiperidin-4-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCSN1CCC(n2cc(-c3cnc4[nH]cc(-c5ccc6c(c5)OC(F)(F)O6)c4c3)cn2)CC1 |
| InChI | InChI=1S/C24H23F2N5O2S/c1-2-34-30-7-5-18(6-8-30)31-14-17(12-29-31)16-9-19-20(13-28-23(19)27-11-16)15-3-4-21-22(10-15)33-24(25,26)32-21/h3-4,9-14,18H,2,5-8H2,1H3,(H,27,28) |
| InChIKey | QFNZDPWMTMNROI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|