C31H43FN3O2Sb — CID 144647345
(E)-3-[(5Z,7Z)-7-ethyl-3,4-dihydro-2H-stibonin-8-yl]-N-[1-[4-(4-fluorocyclohexa-2,4-dien-1-yl)-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]propan-2-yl]-2-methylprop-2-enamide (PubChem CID 144647345) has the molecular formula C31H43FN3O2Sb and a molecular weight of 630.46 g/mol. Its IUPAC name is (E)-3-[(5Z,7Z)-7-ethyl-3,4-dihydro-2H-stibonin-8-yl]-N-[1-[4-(4-fluorocyclohexa-2,4-dien-1-yl)-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]propan-2-yl]-2-methylprop-2-enamide.
| Compound Name | (E)-3-[(5Z,7Z)-7-ethyl-3,4-dihydro-2H-stibonin-8-yl]-N-[1-[4-(4-fluorocyclohexa-2,4-dien-1-yl)-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]propan-2-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 144647345 |
| Molecular Formula | C31H43FN3O2Sb |
| Molecular Weight | 630.46 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | (E)-3-[(5Z,7Z)-7-ethyl-3,4-dihydro-2H-stibonin-8-yl]-N-[1-[4-(4-fluorocyclohexa-2,4-dien-1-yl)-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]propan-2-yl]-2-methylprop-2-enamide |
| SMILES | CCC1=C(\C=C(/C)C(=O)NC(C)CN2CCC3(CC2)C(=O)NCC3C2C=CC(F)=CC2)/C=[Sb]\CCC/C=C\1 |
| InChI | InChI=1S/C31H43FN3O2.Sb/c1-6-8-9-10-25(7-2)22(3)19-23(4)29(36)34-24(5)21-35-17-15-31(16-18-35)28(20-33-30(31)37)26-11-13-27(32)14-12-26;/h3,9-11,13-14,19,24,26,28H,1,6-8,12,15-18,20-21H2,2,4-5H3,(H,33,37)(H,34,36);/b10-9-,23-19+,25-22+; |
| InChIKey | BPPRDAZYQVAMLZ-OQMFKDICSA-N |
| XLogP | 4.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|