C33H60O3Si — CID 14464737
(3S,7R,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-7-triethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 14464737) has the molecular formula C33H60O3Si and a molecular weight of 532.93 g/mol. Its IUPAC name is (3S,7R,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-7-triethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7R,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-7-triethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 14464737 |
| Molecular Formula | C33H60O3Si |
| Molecular Weight | 532.93 g/mol |
| Exact Mass | 532.43 |
| IUPAC Name | (3S,7R,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-7-triethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1C=C2C[C@@H](O)CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCCC(C)(C)O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C33H60O3Si/c1-9-37(10-2,11-3)36-29-22-24-21-25(34)16-19-32(24,7)28-17-20-33(8)26(14-15-27(33)30(28)29)23(4)13-12-18-31(5,6)35/h22-23,25-30,34-35H,9-21H2,1-8H3/t23-,25+,26-,27+,28+,29+,30+,32+,33-/m1/s1 |
| InChIKey | CWZUAMPAADCJNT-KPLPYAJUSA-N |
| XLogP | 8.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.93 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|