C16H31N5O3S — CID 144647472
N-[2-[2-(2-aminoethylamino)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 144647472) has the molecular formula C16H31N5O3S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethylamino)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[2-[2-(2-aminoethylamino)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 144647472 |
| Molecular Formula | C16H31N5O3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | N-[2-[2-(2-aminoethylamino)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | NCCNCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C16H31N5O3S/c17-5-6-18-7-9-24-10-8-19-14(22)4-2-1-3-13-15-12(11-25-13)20-16(23)21-15/h12-13,15,18H,1-11,17H2,(H,19,22)(H2,20,21,23) |
| InChIKey | ORURFCDBSOXZHZ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|