C27H37ClN2O6 — CID 144647973
3-[3-[[4-[(1R,2E,4E)-6-(4-chloro-3-methoxyphenyl)-1-methoxy-5-methylhexa-2,4-dienyl]-2-oxo-1,3-oxazinan-6-yl]methyl]-2-methyloxiran-2-yl]-N-methylpropanamide (PubChem CID 144647973) has the molecular formula C27H37ClN2O6 and a molecular weight of 521.05 g/mol. Its IUPAC name is 3-[3-[[4-[(1R,2E,4E)-6-(4-chloro-3-methoxyphenyl)-1-methoxy-5-methylhexa-2,4-dienyl]-2-oxo-1,3-oxazinan-6-yl]methyl]-2-methyloxiran-2-yl]-N-methylpropanamide.
| Compound Name | 3-[3-[[4-[(1R,2E,4E)-6-(4-chloro-3-methoxyphenyl)-1-methoxy-5-methylhexa-2,4-dienyl]-2-oxo-1,3-oxazinan-6-yl]methyl]-2-methyloxiran-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 144647973 |
| Molecular Formula | C27H37ClN2O6 |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 3-[3-[[4-[(1R,2E,4E)-6-(4-chloro-3-methoxyphenyl)-1-methoxy-5-methylhexa-2,4-dienyl]-2-oxo-1,3-oxazinan-6-yl]methyl]-2-methyloxiran-2-yl]-N-methylpropanamide |
| SMILES | CNC(=O)CCC1(C)OC1CC1CC([C@@H](/C=C/C=C(\C)Cc2ccc(Cl)c(OC)c2)OC)NC(=O)O1 |
| InChI | InChI=1S/C27H37ClN2O6/c1-17(13-18-9-10-20(28)23(14-18)34-5)7-6-8-22(33-4)21-15-19(35-26(32)30-21)16-24-27(2,36-24)12-11-25(31)29-3/h6-10,14,19,21-22,24H,11-13,15-16H2,1-5H3,(H,29,31)(H,30,32)/b8-6+,17-7+/t19?,21?,22-,24?,27?/m1/s1 |
| InChIKey | LGIDNNKVFMNKGV-YEQCTSSJSA-N |
| XLogP | 4.35 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|