C24H31N3O — CID 144648443
8-tert-butyl-16,19-dimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6(11),7,9,12-hexaen-14-one;ethane (PubChem CID 144648443) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 8-tert-butyl-16,19-dimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6(11),7,9,12-hexaen-14-one;ethane.
| Compound Name | 8-tert-butyl-16,19-dimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6(11),7,9,12-hexaen-14-one;ethane |
|---|---|
| PubChem CID | 144648443 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 8-tert-butyl-16,19-dimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6(11),7,9,12-hexaen-14-one;ethane |
| SMILES | CC.CC1C2CCC1(C)c1c2n2ccc3nc(C(C)(C)C)ccc3c2nc1=O |
| InChI | InChI=1S/C22H25N3O.C2H6/c1-12-13-8-10-22(12,5)17-18(13)25-11-9-15-14(19(25)24-20(17)26)6-7-16(23-15)21(2,3)4;1-2/h6-7,9,11-13H,8,10H2,1-5H3;1-2H3 |
| InChIKey | TZDMCCCOPUYCEV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|