About ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride
ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride (PubChem CID 144648794) has the molecular formula C7H14ClN
and a molecular weight of 147.65 g/mol. Its IUPAC name is ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride.
Molecular Properties
| Compound Name | ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride |
| PubChem CID | 144648794 |
| Molecular Formula | C7H14ClN |
| Molecular Weight | 147.65 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride |
| SMILES | C/C=C\N=C(/C)Cl.CC |
| InChI | InChI=1S/C5H8ClN.C2H6/c1-3-4-7-5(2)6;1-2/h3-4H,1-2H3;1-2H3/b4-3-,7-5+; |
| InChIKey | DJRYJTXNQGEBLU-LMMDHOJISA-N |
| XLogP | 3.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride?
The IUPAC name of ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride (CID 144648794) is ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride.
What is the SMILES notation for ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride?
The canonical SMILES for ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride is C/C=C\N=C(/C)Cl.CC.
What is the InChIKey of ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride?
The InChIKey is DJRYJTXNQGEBLU-LMMDHOJISA-N. The full InChI is InChI=1S/C5H8ClN.C2H6/c1-3-4-7-5(2)6;1-2/h3-4H,1-2H3;1-2H3/b4-3-,7-5+;.
What are the key properties of ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride?
ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride has a molecular weight of 147.65 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(Z)-prop-1-enyl]ethanimidoyl chloride is sourced from PubChem (CID 144648794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).