C17H18N2OS — CID 144649324
4,6-dimethyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-11-carbothioic S-acid (PubChem CID 144649324) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 4,6-dimethyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-11-carbothioic S-acid.
| Compound Name | 4,6-dimethyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-11-carbothioic S-acid |
|---|---|
| PubChem CID | 144649324 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4,6-dimethyl-6,11-diazapentacyclo[7.6.1.02,4.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-11-carbothioic S-acid |
| SMILES | CN1CC2(C)CC23c2cccc4c2c(cn4C(=O)S)CC13 |
| InChI | InChI=1S/C17H18N2OS/c1-16-8-17(16)11-4-3-5-12-14(11)10(7-19(12)15(20)21)6-13(17)18(2)9-16/h3-5,7,13H,6,8-9H2,1-2H3,(H,20,21) |
| InChIKey | ARKYCEKVYPNTBV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 25.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|