C16H18F6N6O — CID 144649415
methanamine;1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-[(2,4,5-trifluorophenyl)methylamino]ethanone (PubChem CID 144649415) has the molecular formula C16H18F6N6O and a molecular weight of 424.35 g/mol. Its IUPAC name is methanamine;1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-[(2,4,5-trifluorophenyl)methylamino]ethanone.
| Compound Name | methanamine;1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-[(2,4,5-trifluorophenyl)methylamino]ethanone |
|---|---|
| PubChem CID | 144649415 |
| Molecular Formula | C16H18F6N6O |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | methanamine;1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-[(2,4,5-trifluorophenyl)methylamino]ethanone |
| SMILES | CN.O=C(CNCc1cc(F)c(F)cc1F)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H13F6N5O.CH5N/c16-9-4-11(18)10(17)3-8(9)5-22-6-13(27)25-1-2-26-12(7-25)23-24-14(26)15(19,20)21;1-2/h3-4,22H,1-2,5-7H2;2H2,1H3 |
| InChIKey | MAOJLQZYUDWKNY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|