About (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide
(Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide (PubChem CID 144649697) has the molecular formula C13H26N4O
and a molecular weight of 254.38 g/mol. Its IUPAC name is (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide.
Molecular Properties
| Compound Name | (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide |
| PubChem CID | 144649697 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide |
| SMILES | CN1CCC(CNC(=O)CCC/C(N)=C/N)CC1 |
| InChI | InChI=1S/C13H26N4O/c1-17-7-5-11(6-8-17)10-16-13(18)4-2-3-12(15)9-14/h9,11H,2-8,10,14-15H2,1H3,(H,16,18)/b12-9- |
| InChIKey | HRLCPOWUTNFCHL-XFXZXTDPSA-N |
| XLogP | 0.37 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide?
The IUPAC name of (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide (CID 144649697) is (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide.
What is the SMILES notation for (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide?
The canonical SMILES for (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide is CN1CCC(CNC(=O)CCC/C(N)=C/N)CC1.
What is the InChIKey of (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide?
The InChIKey is HRLCPOWUTNFCHL-XFXZXTDPSA-N. The full InChI is InChI=1S/C13H26N4O/c1-17-7-5-11(6-8-17)10-16-13(18)4-2-3-12(15)9-14/h9,11H,2-8,10,14-15H2,1H3,(H,16,18)/b12-9-.
What are the key properties of (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide?
(Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide has a molecular weight of 254.38 g/mol, XLogP of 0.37, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,6-diamino-N-[(1-methylpiperidin-4-yl)methyl]hex-5-enamide is sourced from PubChem (CID 144649697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).