About (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide
(Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide (PubChem CID 144649713) has the molecular formula C16H32N4O
and a molecular weight of 296.46 g/mol. Its IUPAC name is (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide.
Molecular Properties
| Compound Name | (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide |
| PubChem CID | 144649713 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide |
| SMILES | CCC1CC(NC(=O)CCC/C(N)=C/N)CC(CC)N1C |
| InChI | InChI=1S/C16H32N4O/c1-4-14-9-13(10-15(5-2)20(14)3)19-16(21)8-6-7-12(18)11-17/h11,13-15H,4-10,17-18H2,1-3H3,(H,19,21)/b12-11- |
| InChIKey | QQGFKIIRWQTKFW-QXMHVHEDSA-N |
| XLogP | 1.68 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide?
The IUPAC name of (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide (CID 144649713) is (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide.
What is the SMILES notation for (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide?
The canonical SMILES for (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide is CCC1CC(NC(=O)CCC/C(N)=C/N)CC(CC)N1C.
What is the InChIKey of (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide?
The InChIKey is QQGFKIIRWQTKFW-QXMHVHEDSA-N. The full InChI is InChI=1S/C16H32N4O/c1-4-14-9-13(10-15(5-2)20(14)3)19-16(21)8-6-7-12(18)11-17/h11,13-15H,4-10,17-18H2,1-3H3,(H,19,21)/b12-11-.
What are the key properties of (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide?
(Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide has a molecular weight of 296.46 g/mol, XLogP of 1.68, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,6-diamino-N-(2,6-diethyl-1-methylpiperidin-4-yl)hex-5-enamide is sourced from PubChem (CID 144649713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).