About (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen
(Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen (PubChem CID 144649718) has the molecular formula C3H11N3
and a molecular weight of 89.14 g/mol. Its IUPAC name is (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen |
| PubChem CID | 144649718 |
| Molecular Formula | C3H11N3 |
| Molecular Weight | 89.14 g/mol |
| Exact Mass | 89.10 |
| IUPAC Name | (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen |
| SMILES | C/C(N)=C/NN.[H][H] |
| InChI | InChI=1S/C3H9N3.H2/c1-3(4)2-6-5;/h2,6H,4-5H2,1H3;1H/b3-2-; |
| InChIKey | RWMWMVZEFLKCNZ-OLGQORCHSA-N |
| XLogP | -0.48 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.14 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen?
The IUPAC name of (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen (CID 144649718) is (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen.
What is the SMILES notation for (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen?
The canonical SMILES for (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen is C/C(N)=C/NN.[H][H].
What is the InChIKey of (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen?
The InChIKey is RWMWMVZEFLKCNZ-OLGQORCHSA-N. The full InChI is InChI=1S/C3H9N3.H2/c1-3(4)2-6-5;/h2,6H,4-5H2,1H3;1H/b3-2-;.
What are the key properties of (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen?
(Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen has a molecular weight of 89.14 g/mol, XLogP of -0.48, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-hydrazinylprop-1-en-2-amine;molecular hydrogen is sourced from PubChem (CID 144649718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).