About (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide
(Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide (PubChem CID 144649726) has the molecular formula C14H28N4O
and a molecular weight of 268.40 g/mol. Its IUPAC name is (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide.
Molecular Properties
| Compound Name | (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide |
| PubChem CID | 144649726 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide |
| SMILES | CCN1CCC(N(C)C(=O)CCC/C(N)=C/N)CC1 |
| InChI | InChI=1S/C14H28N4O/c1-3-18-9-7-13(8-10-18)17(2)14(19)6-4-5-12(16)11-15/h11,13H,3-10,15-16H2,1-2H3/b12-11- |
| InChIKey | OOHBNCWCOIBTRT-QXMHVHEDSA-N |
| XLogP | 0.86 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide?
The IUPAC name of (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide (CID 144649726) is (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide.
What is the SMILES notation for (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide?
The canonical SMILES for (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide is CCN1CCC(N(C)C(=O)CCC/C(N)=C/N)CC1.
What is the InChIKey of (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide?
The InChIKey is OOHBNCWCOIBTRT-QXMHVHEDSA-N. The full InChI is InChI=1S/C14H28N4O/c1-3-18-9-7-13(8-10-18)17(2)14(19)6-4-5-12(16)11-15/h11,13H,3-10,15-16H2,1-2H3/b12-11-.
What are the key properties of (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide?
(Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide has a molecular weight of 268.40 g/mol, XLogP of 0.86, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,6-diamino-N-(1-ethylpiperidin-4-yl)-N-methylhex-5-enamide is sourced from PubChem (CID 144649726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).