About (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane
(Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane (PubChem CID 144649727) has the molecular formula C15H36N6O
and a molecular weight of 316.49 g/mol. Its IUPAC name is (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane.
Molecular Properties
| Compound Name | (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane |
| PubChem CID | 144649727 |
| Molecular Formula | C15H36N6O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.30 |
| IUPAC Name | (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane |
| SMILES | CC.CC.CN1CCN(CCCNC(=O)/C(N)=C/NN)CC1 |
| InChI | InChI=1S/C11H24N6O.2C2H6/c1-16-5-7-17(8-6-16)4-2-3-14-11(18)10(12)9-15-13;2*1-2/h9,15H,2-8,12-13H2,1H3,(H,14,18);2*1-2H3/b10-9-;; |
| InChIKey | GMTXZIBVWXFMRB-XXAVUKJNSA-N |
| XLogP | 0.06 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane?
The IUPAC name of (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane (CID 144649727) is (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane.
What is the SMILES notation for (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane?
The canonical SMILES for (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane is CC.CC.CN1CCN(CCCNC(=O)/C(N)=C/NN)CC1.
What is the InChIKey of (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane?
The InChIKey is GMTXZIBVWXFMRB-XXAVUKJNSA-N. The full InChI is InChI=1S/C11H24N6O.2C2H6/c1-16-5-7-17(8-6-16)4-2-3-14-11(18)10(12)9-15-13;2*1-2/h9,15H,2-8,12-13H2,1H3,(H,14,18);2*1-2H3/b10-9-;;.
What are the key properties of (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane?
(Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane has a molecular weight of 316.49 g/mol, XLogP of 0.06, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-amino-3-hydrazinyl-N-[3-(4-methylpiperazin-1-yl)propyl]prop-2-enamide;ethane is sourced from PubChem (CID 144649727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).