About (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine
(7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine (PubChem CID 144649768) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine.
Molecular Properties
| Compound Name | (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine |
| PubChem CID | 144649768 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine |
| SMILES | Cc1ccc2c(n1)/C=C\C=C/CC2 |
| InChI | InChI=1S/C12H13N/c1-10-8-9-11-6-4-2-3-5-7-12(11)13-10/h2-3,5,7-9H,4,6H2,1H3/b3-2-,7-5- |
| InChIKey | DYZXZNOKZGFKDR-ZSBGFAJOSA-N |
| XLogP | 2.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine?
The IUPAC name of (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine (CID 144649768) is (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine.
What is the SMILES notation for (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine?
The canonical SMILES for (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine is Cc1ccc2c(n1)/C=C\C=C/CC2.
What is the InChIKey of (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine?
The InChIKey is DYZXZNOKZGFKDR-ZSBGFAJOSA-N. The full InChI is InChI=1S/C12H13N/c1-10-8-9-11-6-4-2-3-5-7-12(11)13-10/h2-3,5,7-9H,4,6H2,1H3/b3-2-,7-5-.
What are the key properties of (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine?
(7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine has a molecular weight of 171.24 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z,9Z)-2-methyl-5,6-dihydrocycloocta[b]pyridine is sourced from PubChem (CID 144649768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).