About 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine
5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine (PubChem CID 144649841) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine.
Molecular Properties
| Compound Name | 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine |
| PubChem CID | 144649841 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine |
| SMILES | C=CC1=CCC=C(NC(C)C)C=C1 |
| InChI | InChI=1S/C12H17N/c1-4-11-6-5-7-12(9-8-11)13-10(2)3/h4,6-10,13H,1,5H2,2-3H3 |
| InChIKey | QPAWENNBHXKINB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine?
The IUPAC name of 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine (CID 144649841) is 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine is C=CC1=CCC=C(NC(C)C)C=C1.
What is the InChIKey of 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine?
The InChIKey is QPAWENNBHXKINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-4-11-6-5-7-12(9-8-11)13-10(2)3/h4,6-10,13H,1,5H2,2-3H3.
What are the key properties of 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine?
5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine has a molecular weight of 175.27 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-N-propan-2-ylcyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 144649841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).