C20H14O7 — CID 144649891
methyl 7-formyl-10,10-dimethyl-1,3-dioxofuro[3,4-b]xanthene-8-carboxylate (PubChem CID 144649891) has the molecular formula C20H14O7 and a molecular weight of 366.33 g/mol. Its IUPAC name is methyl 7-formyl-10,10-dimethyl-1,3-dioxofuro[3,4-b]xanthene-8-carboxylate.
| Compound Name | methyl 7-formyl-10,10-dimethyl-1,3-dioxofuro[3,4-b]xanthene-8-carboxylate |
|---|---|
| PubChem CID | 144649891 |
| Molecular Formula | C20H14O7 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | methyl 7-formyl-10,10-dimethyl-1,3-dioxofuro[3,4-b]xanthene-8-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1C=O)Oc1cc3c(cc1C2(C)C)C(=O)OC3=O |
| InChI | InChI=1S/C20H14O7/c1-20(2)13-5-10(17(22)25-3)9(8-21)4-15(13)26-16-7-12-11(6-14(16)20)18(23)27-19(12)24/h4-8H,1-3H3 |
| InChIKey | SCIRPXQJNDYTMC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|