About 1,1,3,3-tetraethylurea
1,1,3,3-tetraethylurea (PubChem CID 14465) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 1,1,3,3-tetraethylurea.
Molecular Properties
| Compound Name | 1,1,3,3-tetraethylurea |
| PubChem CID | 14465 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 1,1,3,3-tetraethylurea |
| SMILES | CCN(CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C9H20N2O/c1-5-10(6-2)9(12)11(7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | UWHSPZZUAYSGTB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1,3,3-tetraethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3,3-tetraethylurea?
The IUPAC name of 1,1,3,3-tetraethylurea (CID 14465) is 1,1,3,3-tetraethylurea.
What is the SMILES notation for 1,1,3,3-tetraethylurea?
The canonical SMILES for 1,1,3,3-tetraethylurea is CCN(CC)C(=O)N(CC)CC.
What is the InChIKey of 1,1,3,3-tetraethylurea?
The InChIKey is UWHSPZZUAYSGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-5-10(6-2)9(12)11(7-3)8-4/h5-8H2,1-4H3.
What are the key properties of 1,1,3,3-tetraethylurea?
1,1,3,3-tetraethylurea has a molecular weight of 172.27 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3,3-tetraethylurea is sourced from PubChem (CID 14465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).