C25H35N — CID 144650423
4-tert-butyl-N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-N-[(3E)-penta-1,3-dien-3-yl]aniline (PubChem CID 144650423) has the molecular formula C25H35N and a molecular weight of 349.56 g/mol. Its IUPAC name is 4-tert-butyl-N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-N-[(3E)-penta-1,3-dien-3-yl]aniline.
| Compound Name | 4-tert-butyl-N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-N-[(3E)-penta-1,3-dien-3-yl]aniline |
|---|---|
| PubChem CID | 144650423 |
| Molecular Formula | C25H35N |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 4-tert-butyl-N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-N-[(3E)-penta-1,3-dien-3-yl]aniline |
| SMILES | C=C/C(=C\C)N(C1=CC=C(C(C)(C)C)CC1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H35N/c1-9-21(10-2)26(22-15-11-19(12-16-22)24(3,4)5)23-17-13-20(14-18-23)25(6,7)8/h9-13,15-17H,1,14,18H2,2-8H3/b21-10+ |
| InChIKey | UNNZJCSJCLJHTE-UFFVCSGVSA-N |
| XLogP | 7.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|