About 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid
4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid (PubChem CID 144650593) has the molecular formula C11H13F2NO2S
and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid |
| PubChem CID | 144650593 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid |
| SMILES | Fc1ccc(S)cc1.O=C(O)C1CC(F)CN1 |
| InChI | InChI=1S/C6H5FS.C5H8FNO2/c7-5-1-3-6(8)4-2-5;6-3-1-4(5(8)9)7-2-3/h1-4,8H;3-4,7H,1-2H2,(H,8,9) |
| InChIKey | TUKFTOAWSHKSJE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid?
The IUPAC name of 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid (CID 144650593) is 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid.
What is the SMILES notation for 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid?
The canonical SMILES for 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid is Fc1ccc(S)cc1.O=C(O)C1CC(F)CN1.
What is the InChIKey of 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid?
The InChIKey is TUKFTOAWSHKSJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FS.C5H8FNO2/c7-5-1-3-6(8)4-2-5;6-3-1-4(5(8)9)7-2-3/h1-4,8H;3-4,7H,1-2H2,(H,8,9).
What are the key properties of 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid?
4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid has a molecular weight of 261.29 g/mol, XLogP of 1.89, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzenethiol;4-fluoropyrrolidine-2-carboxylic acid is sourced from PubChem (CID 144650593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).