C5H11NO3 — CID 14465061
1,3-Propanediol, 2-amino-, 1-acetate (PubChem CID 14465061) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is (2-amino-3-hydroxypropyl) acetate.
| Compound Name | 1,3-Propanediol, 2-amino-, 1-acetate |
|---|---|
| PubChem CID | 14465061 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (2-amino-3-hydroxypropyl) acetate |
| SMILES | CC(=O)OCC(CO)N |
| InChI | InChI=1S/C5H11NO3/c1-4(8)9-3-5(6)2-7/h5,7H,2-3,6H2,1H3 |
| InChIKey | PLNKLNFRKMRPIU-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | 94 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |