About 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione
3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione (PubChem CID 144650926) has the molecular formula C18H10N2O6
and a molecular weight of 350.29 g/mol. Its IUPAC name is 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione.
Molecular Properties
| Compound Name | 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione |
| PubChem CID | 144650926 |
| Molecular Formula | C18H10N2O6 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione |
| SMILES | O=C1Oc2ccccc2C(=O)C1/N=N/C1C(=O)Oc2ccccc2C1=O |
| InChI | InChI=1S/C18H10N2O6/c21-15-9-5-1-3-7-11(9)25-17(23)13(15)19-20-14-16(22)10-6-2-4-8-12(10)26-18(14)24/h1-8,13-14H/b20-19+ |
| InChIKey | UJQCGTHEGMBSFK-FMQUCBEESA-N |
| XLogP | 1.78 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione?
The IUPAC name of 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione (CID 144650926) is 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione.
What is the SMILES notation for 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione?
The canonical SMILES for 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione is O=C1Oc2ccccc2C(=O)C1/N=N/C1C(=O)Oc2ccccc2C1=O.
What is the InChIKey of 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione?
The InChIKey is UJQCGTHEGMBSFK-FMQUCBEESA-N. The full InChI is InChI=1S/C18H10N2O6/c21-15-9-5-1-3-7-11(9)25-17(23)13(15)19-20-14-16(22)10-6-2-4-8-12(10)26-18(14)24/h1-8,13-14H/b20-19+.
What are the key properties of 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione?
3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione has a molecular weight of 350.29 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dioxochromen-3-yl)diazenyl]chromene-2,4-dione is sourced from PubChem (CID 144650926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).