[bromo(decanoyloxy)indiganyl] decanoate

C20H38BrInO4 — CID 144651092

IUPAC[bromo(decanoyloxy)indiganyl] decanoate
SMILESCCCCCCCCCC(=O)O[In](Br)OC(=O)CCCCCCCCC
InChIInChI=1S/2C10H20O2.BrH.In/c2*1-2-3-4-5-6-7-8-9-10(11)12;;/h2*2-9H2,1H3,(H,11,12);1H;/q;;;+3/p-3
InChIKeyHEMJVYOWWBTGHH-UHFFFAOYSA-K
MW537.24 g/mol
LogP6.73
Rot. Bonds18

About [bromo(decanoyloxy)indiganyl] decanoate

[bromo(decanoyloxy)indiganyl] decanoate (PubChem CID 144651092) has the molecular formula C20H38BrInO4 and a molecular weight of 537.24 g/mol. Its IUPAC name is [bromo(decanoyloxy)indiganyl] decanoate.

Molecular Properties

Compound Name[bromo(decanoyloxy)indiganyl] decanoate
PubChem CID144651092
Molecular FormulaC20H38BrInO4
Molecular Weight537.24 g/mol
Exact Mass536.10
IUPAC Name[bromo(decanoyloxy)indiganyl] decanoate
SMILESCCCCCCCCCC(=O)O[In](Br)OC(=O)CCCCCCCCC
InChIInChI=1S/2C10H20O2.BrH.In/c2*1-2-3-4-5-6-7-8-9-10(11)12;;/h2*2-9H2,1H3,(H,11,12);1H;/q;;;+3/p-3
InChIKeyHEMJVYOWWBTGHH-UHFFFAOYSA-K
XLogP6.73
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds18
Heavy Atoms26
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500537.24
LogP ≤ 56.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze [bromo(decanoyloxy)indiganyl] decanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [bromo(decanoyloxy)indiganyl] decanoate?
The IUPAC name of [bromo(decanoyloxy)indiganyl] decanoate (CID 144651092) is [bromo(decanoyloxy)indiganyl] decanoate.
What is the SMILES notation for [bromo(decanoyloxy)indiganyl] decanoate?
The canonical SMILES for [bromo(decanoyloxy)indiganyl] decanoate is CCCCCCCCCC(=O)O[In](Br)OC(=O)CCCCCCCCC.
What is the InChIKey of [bromo(decanoyloxy)indiganyl] decanoate?
The InChIKey is HEMJVYOWWBTGHH-UHFFFAOYSA-K. The full InChI is InChI=1S/2C10H20O2.BrH.In/c2*1-2-3-4-5-6-7-8-9-10(11)12;;/h2*2-9H2,1H3,(H,11,12);1H;/q;;;+3/p-3.
What are the key properties of [bromo(decanoyloxy)indiganyl] decanoate?
[bromo(decanoyloxy)indiganyl] decanoate has a molecular weight of 537.24 g/mol, XLogP of 6.73, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [bromo(decanoyloxy)indiganyl] decanoate is sourced from PubChem (CID 144651092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).