About fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate
fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate (PubChem CID 144651224) has the molecular formula C5H2BrClFNO2S
and a molecular weight of 274.50 g/mol. Its IUPAC name is fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate.
Molecular Properties
| Compound Name | fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate |
| PubChem CID | 144651224 |
| Molecular Formula | C5H2BrClFNO2S |
| Molecular Weight | 274.50 g/mol |
| Exact Mass | 272.87 |
| IUPAC Name | fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1nc(Br)sc1Cl)OF |
| InChI | InChI=1S/C5H2BrClFNO2S/c6-5-9-2(4(7)12-5)1-3(10)11-8/h1H2 |
| InChIKey | XXIKCSNIMKGLLS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate?
The IUPAC name of fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate (CID 144651224) is fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate.
What is the SMILES notation for fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate?
The canonical SMILES for fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate is O=C(Cc1nc(Br)sc1Cl)OF.
What is the InChIKey of fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate?
The InChIKey is XXIKCSNIMKGLLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BrClFNO2S/c6-5-9-2(4(7)12-5)1-3(10)11-8/h1H2.
What are the key properties of fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate?
fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate has a molecular weight of 274.50 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2-(2-bromo-5-chloro-1,3-thiazol-4-yl)acetate is sourced from PubChem (CID 144651224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).