C25H32N2O — CID 144651575
3-[6-(4-aminobutyl)naphthalen-2-yl]-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propanamide (PubChem CID 144651575) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is 3-[6-(4-aminobutyl)naphthalen-2-yl]-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propanamide.
| Compound Name | 3-[6-(4-aminobutyl)naphthalen-2-yl]-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propanamide |
|---|---|
| PubChem CID | 144651575 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 3-[6-(4-aminobutyl)naphthalen-2-yl]-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propanamide |
| SMILES | C=C(C)/C=C\C(=C/C)NC(=O)CCc1ccc2cc(CCCCN)ccc2c1 |
| InChI | InChI=1S/C25H32N2O/c1-4-24(14-8-19(2)3)27-25(28)15-11-21-10-13-22-17-20(7-5-6-16-26)9-12-23(22)18-21/h4,8-10,12-14,17-18H,2,5-7,11,15-16,26H2,1,3H3,(H,27,28)/b14-8-,24-4+ |
| InChIKey | IPADWQNZKZONTF-MNWFSYBSSA-N |
| XLogP | 5.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|