About 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane
4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane (PubChem CID 144651616) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane |
| PubChem CID | 144651616 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane |
| SMILES | CC.COc1cc(-n2nc(C)cc2C)ccn1 |
| InChI | InChI=1S/C11H13N3O.C2H6/c1-8-6-9(2)14(13-8)10-4-5-12-11(7-10)15-3;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | JIMWTUPUPKCIAP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane?
The IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane (CID 144651616) is 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane.
What is the SMILES notation for 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane?
The canonical SMILES for 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane is CC.COc1cc(-n2nc(C)cc2C)ccn1.
What is the InChIKey of 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane?
The InChIKey is JIMWTUPUPKCIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O.C2H6/c1-8-6-9(2)14(13-8)10-4-5-12-11(7-10)15-3;1-2/h4-7H,1-3H3;1-2H3.
What are the key properties of 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane?
4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane has a molecular weight of 233.31 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpyrazol-1-yl)-2-methoxypyridine;ethane is sourced from PubChem (CID 144651616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).