C16H24O5 — CID 14465190
methyl 2-[(1R,3aR,6aS)-1-(methoxymethoxy)-2,2-dimethyl-4-methylidene-5-oxo-1,3,6,6a-tetrahydropentalen-3a-yl]acetate (PubChem CID 14465190) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl 2-[(1R,3aR,6aS)-1-(methoxymethoxy)-2,2-dimethyl-4-methylidene-5-oxo-1,3,6,6a-tetrahydropentalen-3a-yl]acetate.
| Compound Name | methyl 2-[(1R,3aR,6aS)-1-(methoxymethoxy)-2,2-dimethyl-4-methylidene-5-oxo-1,3,6,6a-tetrahydropentalen-3a-yl]acetate |
|---|---|
| PubChem CID | 14465190 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | methyl 2-[(1R,3aR,6aS)-1-(methoxymethoxy)-2,2-dimethyl-4-methylidene-5-oxo-1,3,6,6a-tetrahydropentalen-3a-yl]acetate |
| SMILES | C=C1C(=O)C[C@@H]2[C@@H](OCOC)C(C)(C)C[C@]12CC(=O)OC |
| InChI | InChI=1S/C16H24O5/c1-10-12(17)6-11-14(21-9-19-4)15(2,3)8-16(10,11)7-13(18)20-5/h11,14H,1,6-9H2,2-5H3/t11-,14-,16-/m1/s1 |
| InChIKey | VWLLNBPJIGFMRV-DJSGYFEHSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|